C24H27F2NO8S — CID 14697184
diethyl 2-[[3,4-difluoro-2-[2-(4-methylphenyl)sulfonyloxypropoxy]anilino]methylidene]propanedioate (PubChem CID 14697184) has the molecular formula C24H27F2NO8S and a molecular weight of 527.54 g/mol. Its IUPAC name is diethyl 2-[[3,4-difluoro-2-[2-(4-methylphenyl)sulfonyloxypropoxy]anilino]methylidene]propanedioate.
| Compound Name | diethyl 2-[[3,4-difluoro-2-[2-(4-methylphenyl)sulfonyloxypropoxy]anilino]methylidene]propanedioate |
|---|---|
| PubChem CID | 14697184 |
| Molecular Formula | C24H27F2NO8S |
| Molecular Weight | 527.54 g/mol |
| Exact Mass | 527.14 |
| IUPAC Name | diethyl 2-[[3,4-difluoro-2-[2-(4-methylphenyl)sulfonyloxypropoxy]anilino]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CNc1ccc(F)c(F)c1OCC(C)OS(=O)(=O)c1ccc(C)cc1)C(=O)OCC |
| InChI | InChI=1S/C24H27F2NO8S/c1-5-32-23(28)18(24(29)33-6-2)13-27-20-12-11-19(25)21(26)22(20)34-14-16(4)35-36(30,31)17-9-7-15(3)8-10-17/h7-13,16,27H,5-6,14H2,1-4H3 |
| InChIKey | CYGKYOCVMAGLSH-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.54 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|