C12H15F2NO5S — CID 139822412
[(2R)-1-(6-acetamido-2,3-difluorophenoxy)propan-2-yl] methanesulfonate (PubChem CID 139822412) has the molecular formula C12H15F2NO5S and a molecular weight of 323.32 g/mol. Its IUPAC name is [(2R)-1-(6-acetamido-2,3-difluorophenoxy)propan-2-yl] methanesulfonate.
| Compound Name | [(2R)-1-(6-acetamido-2,3-difluorophenoxy)propan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 139822412 |
| Molecular Formula | C12H15F2NO5S |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | [(2R)-1-(6-acetamido-2,3-difluorophenoxy)propan-2-yl] methanesulfonate |
| SMILES | CC(=O)Nc1ccc(F)c(F)c1OC[C@@H](C)OS(C)(=O)=O |
| InChI | InChI=1S/C12H15F2NO5S/c1-7(20-21(3,17)18)6-19-12-10(15-8(2)16)5-4-9(13)11(12)14/h4-5,7H,6H2,1-3H3,(H,15,16)/t7-/m1/s1 |
| InChIKey | JXIBTAKGYCSRKY-SSDOTTSWSA-N |
| XLogP | 1.67 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|