C15H27NO3Si — CID 42643343
ethyl (E)-5-[tert-butyl(dimethyl)silyl]oxy-2-(cyanomethyl)pent-2-enoate (PubChem CID 42643343) has the molecular formula C15H27NO3Si and a molecular weight of 297.47 g/mol. Its IUPAC name is ethyl (E)-5-[tert-butyl(dimethyl)silyl]oxy-2-(cyanomethyl)pent-2-enoate.
| Compound Name | ethyl (E)-5-[tert-butyl(dimethyl)silyl]oxy-2-(cyanomethyl)pent-2-enoate |
|---|---|
| PubChem CID | 42643343 |
| Molecular Formula | C15H27NO3Si |
| Molecular Weight | 297.47 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | ethyl (E)-5-[tert-butyl(dimethyl)silyl]oxy-2-(cyanomethyl)pent-2-enoate |
| SMILES | CCOC(=O)/C(=C/CCO[Si](C)(C)C(C)(C)C)CC#N |
| InChI | InChI=1S/C15H27NO3Si/c1-7-18-14(17)13(10-11-16)9-8-12-19-20(5,6)15(2,3)4/h9H,7-8,10,12H2,1-6H3/b13-9+ |
| InChIKey | ALYHHSIAEGHGSY-UKTHLTGXSA-N |
| XLogP | 3.80 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.47 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|