C20H38O3Si — CID 11660377
[(Z)-6-[tert-butyl(dimethyl)silyl]oxy-2-cyclohexylhex-1-enyl] acetate (PubChem CID 11660377) has the molecular formula C20H38O3Si and a molecular weight of 354.61 g/mol. Its IUPAC name is [(Z)-6-[tert-butyl(dimethyl)silyl]oxy-2-cyclohexylhex-1-enyl] acetate.
| Compound Name | [(Z)-6-[tert-butyl(dimethyl)silyl]oxy-2-cyclohexylhex-1-enyl] acetate |
|---|---|
| PubChem CID | 11660377 |
| Molecular Formula | C20H38O3Si |
| Molecular Weight | 354.61 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | [(Z)-6-[tert-butyl(dimethyl)silyl]oxy-2-cyclohexylhex-1-enyl] acetate |
| SMILES | CC(=O)O/C=C(/CCCCO[Si](C)(C)C(C)(C)C)C1CCCCC1 |
| InChI | InChI=1S/C20H38O3Si/c1-17(21)22-16-19(18-12-8-7-9-13-18)14-10-11-15-23-24(5,6)20(2,3)4/h16,18H,7-15H2,1-6H3/b19-16- |
| InChIKey | KHAPDBMWSBPJSZ-MNDPQUGUSA-N |
| XLogP | 6.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.61 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|