C21H42O5Si — CID 10386422
8-[tert-butyl(dimethyl)silyl]oxy-1-(2,2-diethyl-1,3-dioxolan-4-yl)-2-hydroxyoctan-4-one (PubChem CID 10386422) has the molecular formula C21H42O5Si and a molecular weight of 402.65 g/mol. Its IUPAC name is 8-[tert-butyl(dimethyl)silyl]oxy-1-(2,2-diethyl-1,3-dioxolan-4-yl)-2-hydroxyoctan-4-one.
| Compound Name | 8-[tert-butyl(dimethyl)silyl]oxy-1-(2,2-diethyl-1,3-dioxolan-4-yl)-2-hydroxyoctan-4-one |
|---|---|
| PubChem CID | 10386422 |
| Molecular Formula | C21H42O5Si |
| Molecular Weight | 402.65 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | 8-[tert-butyl(dimethyl)silyl]oxy-1-(2,2-diethyl-1,3-dioxolan-4-yl)-2-hydroxyoctan-4-one |
| SMILES | CCC1(CC)OCC(CC(O)CC(=O)CCCCO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C21H42O5Si/c1-8-21(9-2)24-16-19(26-21)15-18(23)14-17(22)12-10-11-13-25-27(6,7)20(3,4)5/h18-19,23H,8-16H2,1-7H3 |
| InChIKey | HLDJBYHQJKLXNQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.65 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|