C30H54SiSn — CID 177423800
trimethyl-[(1Z,3Z)-7-methyl-1-phenyl-2-tributylstannylocta-1,3-dien-3-yl]silane (PubChem CID 177423800) has the molecular formula C30H54SiSn and a molecular weight of 561.56 g/mol. Its IUPAC name is trimethyl-[(1Z,3Z)-7-methyl-1-phenyl-2-tributylstannylocta-1,3-dien-3-yl]silane.
| Compound Name | trimethyl-[(1Z,3Z)-7-methyl-1-phenyl-2-tributylstannylocta-1,3-dien-3-yl]silane |
|---|---|
| PubChem CID | 177423800 |
| Molecular Formula | C30H54SiSn |
| Molecular Weight | 561.56 g/mol |
| Exact Mass | 562.30 |
| IUPAC Name | trimethyl-[(1Z,3Z)-7-methyl-1-phenyl-2-tributylstannylocta-1,3-dien-3-yl]silane |
| SMILES | CCCC[Sn](CCCC)(CCCC)C(=C\c1ccccc1)/C(=C/CCC(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C18H27Si.3C4H9.Sn/c1-16(2)10-9-13-18(19(3,4)5)15-14-17-11-7-6-8-12-17;3*1-3-4-2;/h6-8,11-14,16H,9-10H2,1-5H3;3*1,3-4H2,2H3;/b15-14?,18-13-;;;; |
| InChIKey | ABVDYPFAOALQIW-XDWOJNJISA-N |
| XLogP | 10.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.56 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|