C13H16O6S — CID 67726952
(Z)-3-(benzenesulfonyl)-2-(2-methoxyethoxymethyl)prop-2-enoic acid (PubChem CID 67726952) has the molecular formula C13H16O6S and a molecular weight of 300.33 g/mol. Its IUPAC name is (Z)-3-(benzenesulfonyl)-2-(2-methoxyethoxymethyl)prop-2-enoic acid.
| Compound Name | (Z)-3-(benzenesulfonyl)-2-(2-methoxyethoxymethyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 67726952 |
| Molecular Formula | C13H16O6S |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | (Z)-3-(benzenesulfonyl)-2-(2-methoxyethoxymethyl)prop-2-enoic acid |
| SMILES | COCCOC/C(=C/S(=O)(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C13H16O6S/c1-18-7-8-19-9-11(13(14)15)10-20(16,17)12-5-3-2-4-6-12/h2-6,10H,7-9H2,1H3,(H,14,15)/b11-10- |
| InChIKey | CKUZLBBNRIEGRZ-KHPPLWFESA-N |
| XLogP | 1.09 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|