C18H26O6S — CID 67727214
tert-butyl (Z)-2-(2-methoxyethoxymethyl)-3-(4-methylphenyl)sulfonylprop-2-enoate (PubChem CID 67727214) has the molecular formula C18H26O6S and a molecular weight of 370.47 g/mol. Its IUPAC name is tert-butyl (Z)-2-(2-methoxyethoxymethyl)-3-(4-methylphenyl)sulfonylprop-2-enoate.
| Compound Name | tert-butyl (Z)-2-(2-methoxyethoxymethyl)-3-(4-methylphenyl)sulfonylprop-2-enoate |
|---|---|
| PubChem CID | 67727214 |
| Molecular Formula | C18H26O6S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | tert-butyl (Z)-2-(2-methoxyethoxymethyl)-3-(4-methylphenyl)sulfonylprop-2-enoate |
| SMILES | COCCOC/C(=C/S(=O)(=O)c1ccc(C)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H26O6S/c1-14-6-8-16(9-7-14)25(20,21)13-15(12-23-11-10-22-5)17(19)24-18(2,3)4/h6-9,13H,10-12H2,1-5H3/b15-13- |
| InChIKey | AKYZQSXNSDGHJW-SQFISAMPSA-N |
| XLogP | 2.66 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|