C27H60OSi2Sn — CID 10348129
trimethyl-[(Z)-1-tributylstannyl-3-tri(propan-2-yl)silyloxyprop-1-enyl]silane (PubChem CID 10348129) has the molecular formula C27H60OSi2Sn and a molecular weight of 575.66 g/mol. Its IUPAC name is trimethyl-[(Z)-1-tributylstannyl-3-tri(propan-2-yl)silyloxyprop-1-enyl]silane.
| Compound Name | trimethyl-[(Z)-1-tributylstannyl-3-tri(propan-2-yl)silyloxyprop-1-enyl]silane |
|---|---|
| PubChem CID | 10348129 |
| Molecular Formula | C27H60OSi2Sn |
| Molecular Weight | 575.66 g/mol |
| Exact Mass | 576.32 |
| IUPAC Name | trimethyl-[(Z)-1-tributylstannyl-3-tri(propan-2-yl)silyloxyprop-1-enyl]silane |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(=C\CO[Si](C(C)C)(C(C)C)C(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C15H33OSi2.3C4H9.Sn/c1-13(2)18(14(3)4,15(5)6)16-11-10-12-17(7,8)9;3*1-3-4-2;/h10,13-15H,11H2,1-9H3;3*1,3-4H2,2H3; |
| InChIKey | UVTRLLQHTHGCIO-UHFFFAOYSA-N |
| XLogP | 10.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.66 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|