C29H62O2SiSn — CID 135593950
(E,3R,4S)-6-tributylstannyl-4-[tri(propan-2-yl)silyloxymethyl]hept-5-en-3-ol (PubChem CID 135593950) has the molecular formula C29H62O2SiSn and a molecular weight of 589.61 g/mol. Its IUPAC name is (E,3R,4S)-6-tributylstannyl-4-[tri(propan-2-yl)silyloxymethyl]hept-5-en-3-ol.
| Compound Name | (E,3R,4S)-6-tributylstannyl-4-[tri(propan-2-yl)silyloxymethyl]hept-5-en-3-ol |
|---|---|
| PubChem CID | 135593950 |
| Molecular Formula | C29H62O2SiSn |
| Molecular Weight | 589.61 g/mol |
| Exact Mass | 590.35 |
| IUPAC Name | (E,3R,4S)-6-tributylstannyl-4-[tri(propan-2-yl)silyloxymethyl]hept-5-en-3-ol |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(C)=C/[C@@H](CO[Si](C(C)C)(C(C)C)C(C)C)[C@H](O)CC |
| InChI | InChI=1S/C17H35O2Si.3C4H9.Sn/c1-9-11-16(17(18)10-2)12-19-20(13(3)4,14(5)6)15(7)8;3*1-3-4-2;/h11,13-18H,10,12H2,1-8H3;3*1,3-4H2,2H3;/t16-,17+;;;;/m0..../s1 |
| InChIKey | JDBMJHHZLFVWMY-OKRZSZEPSA-N |
| XLogP | 9.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.61 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|