C23H44O3Sn — CID 53362347
ethyl (2E,4S,5R,6E)-5-hydroxy-4-methyl-7-tributylstannylocta-2,6-dienoate (PubChem CID 53362347) has the molecular formula C23H44O3Sn and a molecular weight of 487.31 g/mol. Its IUPAC name is ethyl (2E,4S,5R,6E)-5-hydroxy-4-methyl-7-tributylstannylocta-2,6-dienoate.
| Compound Name | ethyl (2E,4S,5R,6E)-5-hydroxy-4-methyl-7-tributylstannylocta-2,6-dienoate |
|---|---|
| PubChem CID | 53362347 |
| Molecular Formula | C23H44O3Sn |
| Molecular Weight | 487.31 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | ethyl (2E,4S,5R,6E)-5-hydroxy-4-methyl-7-tributylstannylocta-2,6-dienoate |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(C)=C/[C@H](O)[C@@H](C)/C=C/C(=O)OCC |
| InChI | InChI=1S/C11H17O3.3C4H9.Sn/c1-4-6-10(12)9(3)7-8-11(13)14-5-2;3*1-3-4-2;/h6-10,12H,5H2,1-3H3;3*1,3-4H2,2H3;/b6-4?,8-7+;;;;/t9-,10-;;;;/m0..../s1 |
| InChIKey | NIKIALHVEOXFHS-PIADFHCRSA-N |
| XLogP | 6.44 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.31 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|