C9H14Cl2O3 — CID 132524974
ethyl (E,4R,5R)-6,6-dichloro-5-hydroxy-4-methylhex-2-enoate (PubChem CID 132524974) has the molecular formula C9H14Cl2O3 and a molecular weight of 241.11 g/mol. Its IUPAC name is ethyl (E,4R,5R)-6,6-dichloro-5-hydroxy-4-methylhex-2-enoate.
| Compound Name | ethyl (E,4R,5R)-6,6-dichloro-5-hydroxy-4-methylhex-2-enoate |
|---|---|
| PubChem CID | 132524974 |
| Molecular Formula | C9H14Cl2O3 |
| Molecular Weight | 241.11 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | ethyl (E,4R,5R)-6,6-dichloro-5-hydroxy-4-methylhex-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@@H](C)[C@@H](O)C(Cl)Cl |
| InChI | InChI=1S/C9H14Cl2O3/c1-3-14-7(12)5-4-6(2)8(13)9(10)11/h4-6,8-9,13H,3H2,1-2H3/b5-4+/t6-,8-/m1/s1 |
| InChIKey | BAUGLPUENHPHLM-IPNZIGHJSA-N |
| XLogP | 1.91 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.11 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|