C22H42O2Sn — CID 11730175
ethyl (2Z)-5-methyl-4-(tributylstannylmethyl)hexa-2,4-dienoate (PubChem CID 11730175) has the molecular formula C22H42O2Sn and a molecular weight of 457.29 g/mol. Its IUPAC name is ethyl (2Z)-5-methyl-4-(tributylstannylmethyl)hexa-2,4-dienoate.
| Compound Name | ethyl (2Z)-5-methyl-4-(tributylstannylmethyl)hexa-2,4-dienoate |
|---|---|
| PubChem CID | 11730175 |
| Molecular Formula | C22H42O2Sn |
| Molecular Weight | 457.29 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | ethyl (2Z)-5-methyl-4-(tributylstannylmethyl)hexa-2,4-dienoate |
| SMILES | CCCC[Sn](CCCC)(CCCC)CC(/C=C\C(=O)OCC)=C(C)C |
| InChI | InChI=1S/C10H15O2.3C4H9.Sn/c1-5-12-10(11)7-6-9(4)8(2)3;3*1-3-4-2;/h6-7H,4-5H2,1-3H3;3*1,3-4H2,2H3;/b7-6-;;;; |
| InChIKey | GWMNZPFGLMSNSK-VSJPESBJSA-N |
| XLogP | 7.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.29 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|