C18H38Sn — CID 14226850
tributyl(2,3-dimethylbut-2-enyl)stannane (PubChem CID 14226850) has the molecular formula C18H38Sn and a molecular weight of 373.21 g/mol. Its IUPAC name is tributyl(2,3-dimethylbut-2-enyl)stannane.
| Compound Name | tributyl(2,3-dimethylbut-2-enyl)stannane |
|---|---|
| PubChem CID | 14226850 |
| Molecular Formula | C18H38Sn |
| Molecular Weight | 373.21 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | tributyl(2,3-dimethylbut-2-enyl)stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)CC(C)=C(C)C |
| InChI | InChI=1S/C6H11.3C4H9.Sn/c1-5(2)6(3)4;3*1-3-4-2;/h1H2,2-4H3;3*1,3-4H2,2H3; |
| InChIKey | UGWXDHMEHSPMJF-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.21 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|