C29H52O3Sn — CID 50901377
ethyl (2E,4E,6E,8R,9S,10E)-9-hydroxy-2,4,6,8-tetramethyl-11-tributylstannylundeca-2,4,6,10-tetraenoate (PubChem CID 50901377) has the molecular formula C29H52O3Sn and a molecular weight of 567.44 g/mol. Its IUPAC name is ethyl (2E,4E,6E,8R,9S,10E)-9-hydroxy-2,4,6,8-tetramethyl-11-tributylstannylundeca-2,4,6,10-tetraenoate.
| Compound Name | ethyl (2E,4E,6E,8R,9S,10E)-9-hydroxy-2,4,6,8-tetramethyl-11-tributylstannylundeca-2,4,6,10-tetraenoate |
|---|---|
| PubChem CID | 50901377 |
| Molecular Formula | C29H52O3Sn |
| Molecular Weight | 567.44 g/mol |
| Exact Mass | 568.29 |
| IUPAC Name | ethyl (2E,4E,6E,8R,9S,10E)-9-hydroxy-2,4,6,8-tetramethyl-11-tributylstannylundeca-2,4,6,10-tetraenoate |
| SMILES | CCCC[Sn](/C=C/[C@@H](O)[C@H](C)/C=C(C)/C=C(C)/C=C(\C)C(=O)OCC)(CCCC)CCCC |
| InChI | InChI=1S/C17H25O3.3C4H9.Sn/c1-7-16(18)14(5)10-12(3)9-13(4)11-15(6)17(19)20-8-2;3*1-3-4-2;/h1,7,9-11,14,16,18H,8H2,2-6H3;3*1,3-4H2,2H3;/b7-1?,12-10+,13-9+,15-11+;;;;/t14-,16-;;;;/m1..../s1 |
| InChIKey | MPYNFEIUGJPCGC-RAEFWLLFSA-N |
| XLogP | 8.33 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.44 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|