C18H35ClOSn — CID 135046193
(3E,5E)-6-chloro-4-tributylstannylhexa-3,5-dien-2-ol (PubChem CID 135046193) has the molecular formula C18H35ClOSn and a molecular weight of 421.64 g/mol. Its IUPAC name is (3E,5E)-6-chloro-4-tributylstannylhexa-3,5-dien-2-ol.
| Compound Name | (3E,5E)-6-chloro-4-tributylstannylhexa-3,5-dien-2-ol |
|---|---|
| PubChem CID | 135046193 |
| Molecular Formula | C18H35ClOSn |
| Molecular Weight | 421.64 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | (3E,5E)-6-chloro-4-tributylstannylhexa-3,5-dien-2-ol |
| SMILES | CCCC[Sn](CCCC)(CCCC)C(/C=C/Cl)=C/C(C)O |
| InChI | InChI=1S/C6H8ClO.3C4H9.Sn/c1-6(8)4-2-3-5-7;3*1-3-4-2;/h3-6,8H,1H3;3*1,3-4H2,2H3;/b4-2?,5-3+;;;; |
| InChIKey | WMLPNCPZRASJEG-UZLSXEPSSA-N |
| XLogP | 6.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.64 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|