C21H42OSn — CID 16664053
(3E,5Z)-2-methyl-4-tributylstannylocta-3,5-dien-2-ol (PubChem CID 16664053) has the molecular formula C21H42OSn and a molecular weight of 429.28 g/mol. Its IUPAC name is (3E,5Z)-2-methyl-4-tributylstannylocta-3,5-dien-2-ol.
| Compound Name | (3E,5Z)-2-methyl-4-tributylstannylocta-3,5-dien-2-ol |
|---|---|
| PubChem CID | 16664053 |
| Molecular Formula | C21H42OSn |
| Molecular Weight | 429.28 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | (3E,5Z)-2-methyl-4-tributylstannylocta-3,5-dien-2-ol |
| SMILES | CC/C=C\C(=C/C(C)(C)O)[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C9H15O.3C4H9.Sn/c1-4-5-6-7-8-9(2,3)10;3*1-3-4-2;/h5-6,8,10H,4H2,1-3H3;3*1,3-4H2,2H3;/b6-5-,8-7?;;;; |
| InChIKey | SSBLCAPYIPUOCB-PFWNJXQMSA-N |
| XLogP | 7.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.28 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|