C15H31IOSi — CID 11176499
[(Z,2S)-4-iodo-2-methylpent-3-enoxy]-tri(propan-2-yl)silane (PubChem CID 11176499) has the molecular formula C15H31IOSi and a molecular weight of 382.40 g/mol. Its IUPAC name is [(Z,2S)-4-iodo-2-methylpent-3-enoxy]-tri(propan-2-yl)silane.
| Compound Name | [(Z,2S)-4-iodo-2-methylpent-3-enoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11176499 |
| Molecular Formula | C15H31IOSi |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | [(Z,2S)-4-iodo-2-methylpent-3-enoxy]-tri(propan-2-yl)silane |
| SMILES | C/C(I)=C/[C@H](C)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C15H31IOSi/c1-11(2)18(12(3)4,13(5)6)17-10-14(7)9-15(8)16/h9,11-14H,10H2,1-8H3/b15-9-/t14-/m0/s1 |
| InChIKey | UJFFXDTXAYWVHK-BUYRESAOSA-N |
| XLogP | 6.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|