C23H50OSiSn — CID 177428281
[(E)-3-ethoxy-5-tributylstannylhex-4-enyl]-trimethylsilane (PubChem CID 177428281) has the molecular formula C23H50OSiSn and a molecular weight of 489.45 g/mol. Its IUPAC name is [(E)-3-ethoxy-5-tributylstannylhex-4-enyl]-trimethylsilane.
| Compound Name | [(E)-3-ethoxy-5-tributylstannylhex-4-enyl]-trimethylsilane |
|---|---|
| PubChem CID | 177428281 |
| Molecular Formula | C23H50OSiSn |
| Molecular Weight | 489.45 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | [(E)-3-ethoxy-5-tributylstannylhex-4-enyl]-trimethylsilane |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(C)=C/C(CC[Si](C)(C)C)OCC |
| InChI | InChI=1S/C11H23OSi.3C4H9.Sn/c1-6-8-11(12-7-2)9-10-13(3,4)5;3*1-3-4-2;/h8,11H,7,9-10H2,1-5H3;3*1,3-4H2,2H3; |
| InChIKey | MQPGARAKXCMNQT-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.45 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|