C22H38OSeSn — CID 10649526
tributyl-[(E)-3-methoxy-1-phenylselanylprop-1-en-2-yl]stannane (PubChem CID 10649526) has the molecular formula C22H38OSeSn and a molecular weight of 516.22 g/mol. Its IUPAC name is tributyl-[(E)-3-methoxy-1-phenylselanylprop-1-en-2-yl]stannane.
| Compound Name | tributyl-[(E)-3-methoxy-1-phenylselanylprop-1-en-2-yl]stannane |
|---|---|
| PubChem CID | 10649526 |
| Molecular Formula | C22H38OSeSn |
| Molecular Weight | 516.22 g/mol |
| Exact Mass | 518.11 |
| IUPAC Name | tributyl-[(E)-3-methoxy-1-phenylselanylprop-1-en-2-yl]stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(=C/[Se]c1ccccc1)COC |
| InChI | InChI=1S/C10H11OSe.3C4H9.Sn/c1-11-8-5-9-12-10-6-3-2-4-7-10;3*1-3-4-2;/h2-4,6-7,9H,8H2,1H3;3*1,3-4H2,2H3; |
| InChIKey | FRJDOBRHHBVHMB-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.22 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|