C24H40OSn — CID 10671765
tributyl(1-phenylmethoxypenta-2,3-dien-2-yl)stannane (PubChem CID 10671765) has the molecular formula C24H40OSn and a molecular weight of 463.29 g/mol. Its IUPAC name is tributyl(1-phenylmethoxypenta-2,3-dien-2-yl)stannane.
| Compound Name | tributyl(1-phenylmethoxypenta-2,3-dien-2-yl)stannane |
|---|---|
| PubChem CID | 10671765 |
| Molecular Formula | C24H40OSn |
| Molecular Weight | 463.29 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | tributyl(1-phenylmethoxypenta-2,3-dien-2-yl)stannane |
| SMILES | CC=C=C(COCc1ccccc1)[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C12H13O.3C4H9.Sn/c1-2-3-7-10-13-11-12-8-5-4-6-9-12;3*1-3-4-2;/h2,4-6,8-9H,10-11H2,1H3;3*1,3-4H2,2H3; |
| InChIKey | KJJVIRRCSYNCCS-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.29 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |