About butane;phenol;phenylmethoxymethylbenzene
butane;phenol;phenylmethoxymethylbenzene (PubChem CID 174556357) has the molecular formula C24H30O2
and a molecular weight of 350.50 g/mol. Its IUPAC name is butane;phenol;phenylmethoxymethylbenzene.
Molecular Properties
| Compound Name | butane;phenol;phenylmethoxymethylbenzene |
| PubChem CID | 174556357 |
| Molecular Formula | C24H30O2 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | butane;phenol;phenylmethoxymethylbenzene |
| SMILES | CCCC.Oc1ccccc1.c1ccc(COCc2ccccc2)cc1 |
| InChI | InChI=1S/C14H14O.C6H6O.C4H10/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;7-6-4-2-1-3-5-6;1-3-4-2/h1-10H,11-12H2;1-5,7H;3-4H2,1-2H3 |
| InChIKey | ZIXQXWVGSOMMRP-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butane;phenol;phenylmethoxymethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;phenol;phenylmethoxymethylbenzene?
The IUPAC name of butane;phenol;phenylmethoxymethylbenzene (CID 174556357) is butane;phenol;phenylmethoxymethylbenzene.
What is the SMILES notation for butane;phenol;phenylmethoxymethylbenzene?
The canonical SMILES for butane;phenol;phenylmethoxymethylbenzene is CCCC.Oc1ccccc1.c1ccc(COCc2ccccc2)cc1.
What is the InChIKey of butane;phenol;phenylmethoxymethylbenzene?
The InChIKey is ZIXQXWVGSOMMRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O.C6H6O.C4H10/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;7-6-4-2-1-3-5-6;1-3-4-2/h1-10H,11-12H2;1-5,7H;3-4H2,1-2H3.
What are the key properties of butane;phenol;phenylmethoxymethylbenzene?
butane;phenol;phenylmethoxymethylbenzene has a molecular weight of 350.50 g/mol, XLogP of 6.60, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butane;phenol;phenylmethoxymethylbenzene is sourced from PubChem (CID 174556357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).