C31H57FO3SiSn — CID 70294580
tert-butyl-[(2Z)-2-[fluoro(tributylstannyl)methylidene]-4-[(4-methoxyphenyl)methoxy]butoxy]-dimethylsilane (PubChem CID 70294580) has the molecular formula C31H57FO3SiSn and a molecular weight of 643.59 g/mol. Its IUPAC name is tert-butyl-[(2Z)-2-[fluoro(tributylstannyl)methylidene]-4-[(4-methoxyphenyl)methoxy]butoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2Z)-2-[fluoro(tributylstannyl)methylidene]-4-[(4-methoxyphenyl)methoxy]butoxy]-dimethylsilane |
|---|---|
| PubChem CID | 70294580 |
| Molecular Formula | C31H57FO3SiSn |
| Molecular Weight | 643.59 g/mol |
| Exact Mass | 644.31 |
| IUPAC Name | tert-butyl-[(2Z)-2-[fluoro(tributylstannyl)methylidene]-4-[(4-methoxyphenyl)methoxy]butoxy]-dimethylsilane |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(F)=C(/CCOCc1ccc(OC)cc1)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H30FO3Si.3C4H9.Sn/c1-19(2,3)24(5,6)23-15-17(13-20)11-12-22-14-16-7-9-18(21-4)10-8-16;3*1-3-4-2;/h7-10H,11-12,14-15H2,1-6H3;3*1,3-4H2,2H3; |
| InChIKey | SBBGKBLFMCCHNF-UHFFFAOYSA-N |
| XLogP | 10.24 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.59 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|