C31H48O6S2Si — CID 101383914
methyl (2R,3R,4S,5R)-2-[tert-butyl(dimethyl)silyl]oxy-6,6-bis(ethylsulfanyl)-3-hydroxy-4,5-bis(phenylmethoxy)hexanoate (PubChem CID 101383914) has the molecular formula C31H48O6S2Si and a molecular weight of 608.94 g/mol. Its IUPAC name is methyl (2R,3R,4S,5R)-2-[tert-butyl(dimethyl)silyl]oxy-6,6-bis(ethylsulfanyl)-3-hydroxy-4,5-bis(phenylmethoxy)hexanoate.
| Compound Name | methyl (2R,3R,4S,5R)-2-[tert-butyl(dimethyl)silyl]oxy-6,6-bis(ethylsulfanyl)-3-hydroxy-4,5-bis(phenylmethoxy)hexanoate |
|---|---|
| PubChem CID | 101383914 |
| Molecular Formula | C31H48O6S2Si |
| Molecular Weight | 608.94 g/mol |
| Exact Mass | 608.27 |
| IUPAC Name | methyl (2R,3R,4S,5R)-2-[tert-butyl(dimethyl)silyl]oxy-6,6-bis(ethylsulfanyl)-3-hydroxy-4,5-bis(phenylmethoxy)hexanoate |
| SMILES | CCSC(SCC)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C31H48O6S2Si/c1-9-38-30(39-10-2)28(36-22-24-19-15-12-16-20-24)26(35-21-23-17-13-11-14-18-23)25(32)27(29(33)34-6)37-40(7,8)31(3,4)5/h11-20,25-28,30,32H,9-10,21-22H2,1-8H3/t25-,26+,27-,28-/m1/s1 |
| InChIKey | CLWJNMBNCOBNPR-JUDWXZBOSA-N |
| XLogP | 6.91 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.94 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|