C36H39NO10 — CID 10841897
[(1S,2R,6S,7R,8S,12S)-7-acetamido-9-[(4-methoxyphenyl)methoxy]-4-oxo-8,12-bis(phenylmethoxy)-3,10-dioxatricyclo[5.3.2.02,6]dodecan-11-yl] acetate (PubChem CID 10841897) has the molecular formula C36H39NO10 and a molecular weight of 645.71 g/mol. Its IUPAC name is [(1S,2R,6S,7R,8S,12S)-7-acetamido-9-[(4-methoxyphenyl)methoxy]-4-oxo-8,12-bis(phenylmethoxy)-3,10-dioxatricyclo[5.3.2.02,6]dodecan-11-yl] acetate.
| Compound Name | [(1S,2R,6S,7R,8S,12S)-7-acetamido-9-[(4-methoxyphenyl)methoxy]-4-oxo-8,12-bis(phenylmethoxy)-3,10-dioxatricyclo[5.3.2.02,6]dodecan-11-yl] acetate |
|---|---|
| PubChem CID | 10841897 |
| Molecular Formula | C36H39NO10 |
| Molecular Weight | 645.71 g/mol |
| Exact Mass | 645.26 |
| IUPAC Name | [(1S,2R,6S,7R,8S,12S)-7-acetamido-9-[(4-methoxyphenyl)methoxy]-4-oxo-8,12-bis(phenylmethoxy)-3,10-dioxatricyclo[5.3.2.02,6]dodecan-11-yl] acetate |
| SMILES | COc1ccc(COC2O[C@@H]3C(OC(C)=O)[C@@H](OCc4ccccc4)[C@@](NC(C)=O)([C@@H]2OCc2ccccc2)[C@@H]2CC(=O)O[C@@H]32)cc1 |
| InChI | InChI=1S/C36H39NO10/c1-22(38)37-36-28-18-29(40)46-30(28)31(32(45-23(2)39)33(36)42-19-24-10-6-4-7-11-24)47-35(34(36)43-20-25-12-8-5-9-13-25)44-21-26-14-16-27(41-3)17-15-26/h4-17,28,30-35H,18-21H2,1-3H3,(H,37,38)/t28-,30-,31+,32?,33-,34-,35?,36-/m1/s1 |
| InChIKey | RTLKGSVIUWOBBP-SJKKAIKASA-N |
| XLogP | 3.86 |
| TPSA | 127.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.71 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |