C33H37NO8 — CID 10745720
N-[(1S,6R,7S,8S,10S)-4-(hydroxymethyl)-8-[(4-methoxyphenyl)methoxy]-7,10-bis(phenylmethoxy)-3,9-dioxatricyclo[4.3.1.02,4]decan-6-yl]acetamide (PubChem CID 10745720) has the molecular formula C33H37NO8 and a molecular weight of 575.66 g/mol. Its IUPAC name is N-[(1S,6R,7S,8S,10S)-4-(hydroxymethyl)-8-[(4-methoxyphenyl)methoxy]-7,10-bis(phenylmethoxy)-3,9-dioxatricyclo[4.3.1.02,4]decan-6-yl]acetamide.
| Compound Name | N-[(1S,6R,7S,8S,10S)-4-(hydroxymethyl)-8-[(4-methoxyphenyl)methoxy]-7,10-bis(phenylmethoxy)-3,9-dioxatricyclo[4.3.1.02,4]decan-6-yl]acetamide |
|---|---|
| PubChem CID | 10745720 |
| Molecular Formula | C33H37NO8 |
| Molecular Weight | 575.66 g/mol |
| Exact Mass | 575.25 |
| IUPAC Name | N-[(1S,6R,7S,8S,10S)-4-(hydroxymethyl)-8-[(4-methoxyphenyl)methoxy]-7,10-bis(phenylmethoxy)-3,9-dioxatricyclo[4.3.1.02,4]decan-6-yl]acetamide |
| SMILES | COc1ccc(CO[C@H]2O[C@@H]3C4OC4(CO)C[C@](NC(C)=O)([C@@H]2OCc2ccccc2)[C@@H]3OCc2ccccc2)cc1 |
| InChI | InChI=1S/C33H37NO8/c1-22(36)34-33-20-32(21-35)28(42-32)27(29(33)38-17-23-9-5-3-6-10-23)41-31(30(33)39-18-24-11-7-4-8-12-24)40-19-25-13-15-26(37-2)16-14-25/h3-16,27-31,35H,17-21H2,1-2H3,(H,34,36)/t27-,28?,29-,30-,31+,32?,33-/m1/s1 |
| InChIKey | LBDWRVSSYXUSGN-VZBBAGLISA-N |
| XLogP | 3.52 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.66 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|