C32H36O9 — CID 10875433
[(Z)-[(3S,4S,5R,6S)-6-methoxy-3,5-bis[(4-methoxyphenyl)methoxy]-4-phenylmethoxyoxan-2-ylidene]methyl] acetate (PubChem CID 10875433) has the molecular formula C32H36O9 and a molecular weight of 564.63 g/mol. Its IUPAC name is [(Z)-[(3S,4S,5R,6S)-6-methoxy-3,5-bis[(4-methoxyphenyl)methoxy]-4-phenylmethoxyoxan-2-ylidene]methyl] acetate.
| Compound Name | [(Z)-[(3S,4S,5R,6S)-6-methoxy-3,5-bis[(4-methoxyphenyl)methoxy]-4-phenylmethoxyoxan-2-ylidene]methyl] acetate |
|---|---|
| PubChem CID | 10875433 |
| Molecular Formula | C32H36O9 |
| Molecular Weight | 564.63 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | [(Z)-[(3S,4S,5R,6S)-6-methoxy-3,5-bis[(4-methoxyphenyl)methoxy]-4-phenylmethoxyoxan-2-ylidene]methyl] acetate |
| SMILES | COc1ccc(CO[C@H]2[C@@H](OC)O/C(=C\OC(C)=O)[C@@H](OCc3ccc(OC)cc3)[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C32H36O9/c1-22(33)37-21-28-29(38-19-24-10-14-26(34-2)15-11-24)30(39-18-23-8-6-5-7-9-23)31(32(36-4)41-28)40-20-25-12-16-27(35-3)17-13-25/h5-17,21,29-32H,18-20H2,1-4H3/b28-21-/t29-,30+,31-,32+/m1/s1 |
| InChIKey | QTQJRLWQGTYYIX-OHRBWJJVSA-N |
| XLogP | 5.17 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.63 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|