C23H40NO4Si+ — CID 68848838
(2R,4S)-1-tert-butyl-4-[tert-butyl(dimethyl)silyl]oxy-2-(phenylmethoxymethyl)pyrrolidin-1-ium-1-carboxylic acid (PubChem CID 68848838) has the molecular formula C23H40NO4Si+ and a molecular weight of 422.66 g/mol. Its IUPAC name is (2R,4S)-1-tert-butyl-4-[tert-butyl(dimethyl)silyl]oxy-2-(phenylmethoxymethyl)pyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R,4S)-1-tert-butyl-4-[tert-butyl(dimethyl)silyl]oxy-2-(phenylmethoxymethyl)pyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 68848838 |
| Molecular Formula | C23H40NO4Si+ |
| Molecular Weight | 422.66 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | (2R,4S)-1-tert-butyl-4-[tert-butyl(dimethyl)silyl]oxy-2-(phenylmethoxymethyl)pyrrolidin-1-ium-1-carboxylic acid |
| SMILES | CC(C)(C)[N+]1(C(=O)O)C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C23H39NO4Si/c1-22(2,3)24(21(25)26)15-20(28-29(7,8)23(4,5)6)14-19(24)17-27-16-18-12-10-9-11-13-18/h9-13,19-20H,14-17H2,1-8H3/p+1/t19-,20+,24?/m1/s1 |
| InChIKey | LQLPHTDWHHYEIJ-HVUWCZLESA-O |
| XLogP | 5.66 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.66 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|