C32H41NO5Si — CID 10650271
benzyl N-[[(8R,9S,13S,14S)-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-17-oxo-6,7,8,9,11,12-hexahydrocyclopenta[a]phenanthren-14-yl]oxy]carbamate (PubChem CID 10650271) has the molecular formula C32H41NO5Si and a molecular weight of 547.77 g/mol. Its IUPAC name is benzyl N-[[(8R,9S,13S,14S)-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-17-oxo-6,7,8,9,11,12-hexahydrocyclopenta[a]phenanthren-14-yl]oxy]carbamate.
| Compound Name | benzyl N-[[(8R,9S,13S,14S)-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-17-oxo-6,7,8,9,11,12-hexahydrocyclopenta[a]phenanthren-14-yl]oxy]carbamate |
|---|---|
| PubChem CID | 10650271 |
| Molecular Formula | C32H41NO5Si |
| Molecular Weight | 547.77 g/mol |
| Exact Mass | 547.28 |
| IUPAC Name | benzyl N-[[(8R,9S,13S,14S)-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-17-oxo-6,7,8,9,11,12-hexahydrocyclopenta[a]phenanthren-14-yl]oxy]carbamate |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)C=C[C@]12ONC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H41NO5Si/c1-30(2,3)39(5,6)37-24-13-14-25-23(20-24)12-15-27-26(25)16-18-31(4)28(34)17-19-32(27,31)38-33-29(35)36-21-22-10-8-7-9-11-22/h7-11,13-14,17,19-20,26-27H,12,15-16,18,21H2,1-6H3,(H,33,35)/t26-,27-,31-,32+/m1/s1 |
| InChIKey | DQCKGFMRTNDPII-ITWZUIQWSA-N |
| XLogP | 7.25 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.77 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|