C26H37NO5Si — CID 59027859
benzyl N-[(1R,2S)-3-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-1-hydroxy-1-[(2S)-2-methyloxiran-2-yl]propan-2-yl]carbamate (PubChem CID 59027859) has the molecular formula C26H37NO5Si and a molecular weight of 471.67 g/mol. Its IUPAC name is benzyl N-[(1R,2S)-3-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-1-hydroxy-1-[(2S)-2-methyloxiran-2-yl]propan-2-yl]carbamate.
| Compound Name | benzyl N-[(1R,2S)-3-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-1-hydroxy-1-[(2S)-2-methyloxiran-2-yl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 59027859 |
| Molecular Formula | C26H37NO5Si |
| Molecular Weight | 471.67 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | benzyl N-[(1R,2S)-3-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-1-hydroxy-1-[(2S)-2-methyloxiran-2-yl]propan-2-yl]carbamate |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(C[C@H](NC(=O)OCc2ccccc2)[C@@H](O)[C@]2(C)CO2)cc1 |
| InChI | InChI=1S/C26H37NO5Si/c1-25(2,3)33(5,6)32-21-14-12-19(13-15-21)16-22(23(28)26(4)18-31-26)27-24(29)30-17-20-10-8-7-9-11-20/h7-15,22-23,28H,16-18H2,1-6H3,(H,27,29)/t22-,23+,26-/m0/s1 |
| InChIKey | IFMDWQKNEXODAV-ZEVJAHDQSA-N |
| XLogP | 5.06 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.67 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|