C28H33O6P — CID 101421218
[(E,2S,3R)-3-benzyl-1,6-bis(phenylmethoxy)hex-4-en-2-yl] methyl hydrogen phosphate (PubChem CID 101421218) has the molecular formula C28H33O6P and a molecular weight of 496.54 g/mol. Its IUPAC name is [(E,2S,3R)-3-benzyl-1,6-bis(phenylmethoxy)hex-4-en-2-yl] methyl hydrogen phosphate.
| Compound Name | [(E,2S,3R)-3-benzyl-1,6-bis(phenylmethoxy)hex-4-en-2-yl] methyl hydrogen phosphate |
|---|---|
| PubChem CID | 101421218 |
| Molecular Formula | C28H33O6P |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | [(E,2S,3R)-3-benzyl-1,6-bis(phenylmethoxy)hex-4-en-2-yl] methyl hydrogen phosphate |
| SMILES | COP(=O)(O)O[C@H](COCc1ccccc1)[C@@H](/C=C/COCc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C28H33O6P/c1-31-35(29,30)34-28(23-33-22-26-16-9-4-10-17-26)27(20-24-12-5-2-6-13-24)18-11-19-32-21-25-14-7-3-8-15-25/h2-18,27-28H,19-23H2,1H3,(H,29,30)/b18-11+/t27-,28+/m0/s1 |
| InChIKey | MYXABZMWPGWBLI-OEOOWAHBSA-N |
| XLogP | 5.97 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|