C17H24O4 — CID 11266323
(2S)-2-[(E,1R)-1-(methoxymethoxy)-6-phenylmethoxyhex-4-enyl]oxirane (PubChem CID 11266323) has the molecular formula C17H24O4 and a molecular weight of 292.37 g/mol. Its IUPAC name is (2S)-2-[(E,1R)-1-(methoxymethoxy)-6-phenylmethoxyhex-4-enyl]oxirane.
| Compound Name | (2S)-2-[(E,1R)-1-(methoxymethoxy)-6-phenylmethoxyhex-4-enyl]oxirane |
|---|---|
| PubChem CID | 11266323 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | (2S)-2-[(E,1R)-1-(methoxymethoxy)-6-phenylmethoxyhex-4-enyl]oxirane |
| SMILES | COCO[C@H](CC/C=C/COCc1ccccc1)[C@@H]1CO1 |
| InChI | InChI=1S/C17H24O4/c1-18-14-21-16(17-13-20-17)10-6-3-7-11-19-12-15-8-4-2-5-9-15/h2-5,7-9,16-17H,6,10-14H2,1H3/b7-3+/t16-,17+/m1/s1 |
| InChIKey | UWBBWTMVZMZUEJ-QITRJSSMSA-N |
| XLogP | 2.93 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|