C39H38O4 — CID 10555079
2-[1-[(2R,3S,4R)-1,3,4-tris(phenylmethoxy)hex-5-en-2-yl]oxyethenyl]naphthalene (PubChem CID 10555079) has the molecular formula C39H38O4 and a molecular weight of 570.73 g/mol. Its IUPAC name is 2-[1-[(2R,3S,4R)-1,3,4-tris(phenylmethoxy)hex-5-en-2-yl]oxyethenyl]naphthalene.
| Compound Name | 2-[1-[(2R,3S,4R)-1,3,4-tris(phenylmethoxy)hex-5-en-2-yl]oxyethenyl]naphthalene |
|---|---|
| PubChem CID | 10555079 |
| Molecular Formula | C39H38O4 |
| Molecular Weight | 570.73 g/mol |
| Exact Mass | 570.28 |
| IUPAC Name | 2-[1-[(2R,3S,4R)-1,3,4-tris(phenylmethoxy)hex-5-en-2-yl]oxyethenyl]naphthalene |
| SMILES | C=C[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](COCc1ccccc1)OC(=C)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C39H38O4/c1-3-37(41-27-32-17-9-5-10-18-32)39(42-28-33-19-11-6-12-20-33)38(29-40-26-31-15-7-4-8-16-31)43-30(2)35-24-23-34-21-13-14-22-36(34)25-35/h3-25,37-39H,1-2,26-29H2/t37-,38-,39+/m1/s1 |
| InChIKey | AQYZQZVBFHBFOE-PHAUOLPESA-N |
| XLogP | 8.77 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.73 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|