C34H36N2O4 — CID 102281967
(2S,3S,4S,5S)-2-(benzylamino)-5-hydroxy-3,4,6-tris(phenylmethoxy)hexanenitrile (PubChem CID 102281967) has the molecular formula C34H36N2O4 and a molecular weight of 536.67 g/mol. Its IUPAC name is (2S,3S,4S,5S)-2-(benzylamino)-5-hydroxy-3,4,6-tris(phenylmethoxy)hexanenitrile.
| Compound Name | (2S,3S,4S,5S)-2-(benzylamino)-5-hydroxy-3,4,6-tris(phenylmethoxy)hexanenitrile |
|---|---|
| PubChem CID | 102281967 |
| Molecular Formula | C34H36N2O4 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | (2S,3S,4S,5S)-2-(benzylamino)-5-hydroxy-3,4,6-tris(phenylmethoxy)hexanenitrile |
| SMILES | N#C[C@H](NCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C34H36N2O4/c35-21-31(36-22-27-13-5-1-6-14-27)33(39-24-29-17-9-3-10-18-29)34(40-25-30-19-11-4-12-20-30)32(37)26-38-23-28-15-7-2-8-16-28/h1-20,31-34,36-37H,22-26H2/t31-,32-,33-,34-/m0/s1 |
| InChIKey | VJXPNIOTYRPQLH-CUPIEXAXSA-N |
| XLogP | 5.42 |
| TPSA | 83.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |