C42H46O8 — CID 101162331
(2R,3R)-4-[6-[(2R,3R)-4-hydroxy-2,3-bis(phenylmethoxy)butoxy]hexa-2,4-diynoxy]-2,3-bis(phenylmethoxy)butan-1-ol (PubChem CID 101162331) has the molecular formula C42H46O8 and a molecular weight of 678.82 g/mol. Its IUPAC name is (2R,3R)-4-[6-[(2R,3R)-4-hydroxy-2,3-bis(phenylmethoxy)butoxy]hexa-2,4-diynoxy]-2,3-bis(phenylmethoxy)butan-1-ol.
| Compound Name | (2R,3R)-4-[6-[(2R,3R)-4-hydroxy-2,3-bis(phenylmethoxy)butoxy]hexa-2,4-diynoxy]-2,3-bis(phenylmethoxy)butan-1-ol |
|---|---|
| PubChem CID | 101162331 |
| Molecular Formula | C42H46O8 |
| Molecular Weight | 678.82 g/mol |
| Exact Mass | 678.32 |
| IUPAC Name | (2R,3R)-4-[6-[(2R,3R)-4-hydroxy-2,3-bis(phenylmethoxy)butoxy]hexa-2,4-diynoxy]-2,3-bis(phenylmethoxy)butan-1-ol |
| SMILES | OC[C@@H](OCc1ccccc1)[C@@H](COCC#CC#CCOC[C@@H](OCc1ccccc1)[C@@H](CO)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C42H46O8/c43-27-39(47-29-35-17-7-3-8-18-35)41(49-31-37-21-11-5-12-22-37)33-45-25-15-1-2-16-26-46-34-42(50-32-38-23-13-6-14-24-38)40(28-44)48-30-36-19-9-4-10-20-36/h3-14,17-24,39-44H,25-34H2/t39-,40-,41-,42-/m1/s1 |
| InChIKey | NHRJCKKPBRDDBP-BMGLKWEPSA-N |
| XLogP | 5.35 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.82 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|