C33H45NO4Si — CID 15531382
(2,4,6-trimethylphenyl) (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(4-methoxyanilino)-5-phenylpentanoate (PubChem CID 15531382) has the molecular formula C33H45NO4Si and a molecular weight of 547.81 g/mol. Its IUPAC name is (2,4,6-trimethylphenyl) (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(4-methoxyanilino)-5-phenylpentanoate.
| Compound Name | (2,4,6-trimethylphenyl) (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(4-methoxyanilino)-5-phenylpentanoate |
|---|---|
| PubChem CID | 15531382 |
| Molecular Formula | C33H45NO4Si |
| Molecular Weight | 547.81 g/mol |
| Exact Mass | 547.31 |
| IUPAC Name | (2,4,6-trimethylphenyl) (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(4-methoxyanilino)-5-phenylpentanoate |
| SMILES | COc1ccc(N[C@H](CCc2ccccc2)[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)Oc2c(C)cc(C)cc2C)cc1 |
| InChI | InChI=1S/C33H45NO4Si/c1-23-21-24(2)30(25(3)22-23)37-32(35)31(38-39(8,9)33(4,5)6)29(20-15-26-13-11-10-12-14-26)34-27-16-18-28(36-7)19-17-27/h10-14,16-19,21-22,29,31,34H,15,20H2,1-9H3/t29-,31-/m1/s1 |
| InChIKey | CDTRQOPQIOVJEO-BVRKHOPBSA-N |
| XLogP | 8.03 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.81 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|