C13H16N2O2S — CID 104771159
2-(4-methoxyanilino)-2-(4-methyl-1,3-thiazol-2-yl)ethanol (PubChem CID 104771159) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is 2-(4-methoxyanilino)-2-(4-methyl-1,3-thiazol-2-yl)ethanol.
| Compound Name | 2-(4-methoxyanilino)-2-(4-methyl-1,3-thiazol-2-yl)ethanol |
|---|---|
| PubChem CID | 104771159 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 2-(4-methoxyanilino)-2-(4-methyl-1,3-thiazol-2-yl)ethanol |
| SMILES | COc1ccc(NC(CO)c2nc(C)cs2)cc1 |
| InChI | InChI=1S/C13H16N2O2S/c1-9-8-18-13(14-9)12(7-16)15-10-3-5-11(17-2)6-4-10/h3-6,8,12,15-16H,7H2,1-2H3 |
| InChIKey | AADORWZCIHWTHR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|