C25H38O6Si — CID 23635699
methyl 10-acetyloxy-7-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-10-phenyldec-2-ynoate (PubChem CID 23635699) has the molecular formula C25H38O6Si and a molecular weight of 462.66 g/mol. Its IUPAC name is methyl 10-acetyloxy-7-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-10-phenyldec-2-ynoate.
| Compound Name | methyl 10-acetyloxy-7-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-10-phenyldec-2-ynoate |
|---|---|
| PubChem CID | 23635699 |
| Molecular Formula | C25H38O6Si |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | methyl 10-acetyloxy-7-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-10-phenyldec-2-ynoate |
| SMILES | COC(=O)C#CC(O)CCC(CCC(OC(C)=O)c1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H38O6Si/c1-19(26)30-23(20-11-9-8-10-12-20)17-16-22(31-32(6,7)25(2,3)4)15-13-21(27)14-18-24(28)29-5/h8-12,21-23,27H,13,15-17H2,1-7H3 |
| InChIKey | YNCHHRRVVQHBLE-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|