C20H33NO3Si — CID 59712846
(3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-oxo-N-[(1S)-1-phenylethyl]hexanamide (PubChem CID 59712846) has the molecular formula C20H33NO3Si and a molecular weight of 363.57 g/mol. Its IUPAC name is (3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-oxo-N-[(1S)-1-phenylethyl]hexanamide.
| Compound Name | (3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-oxo-N-[(1S)-1-phenylethyl]hexanamide |
|---|---|
| PubChem CID | 59712846 |
| Molecular Formula | C20H33NO3Si |
| Molecular Weight | 363.57 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | (3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-oxo-N-[(1S)-1-phenylethyl]hexanamide |
| SMILES | CC(=O)C[C@H](CC(=O)N[C@@H](C)c1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H33NO3Si/c1-15(22)13-18(24-25(6,7)20(3,4)5)14-19(23)21-16(2)17-11-9-8-10-12-17/h8-12,16,18H,13-14H2,1-7H3,(H,21,23)/t16-,18+/m0/s1 |
| InChIKey | BNDOBWUXGPEJSP-FUHWJXTLSA-N |
| XLogP | 4.62 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.57 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|