C19H26O4 — CID 135077924
[(E)-11-hydroxy-7-oxo-1-phenylundec-2-enyl] acetate (PubChem CID 135077924) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is [(E)-11-hydroxy-7-oxo-1-phenylundec-2-enyl] acetate.
| Compound Name | [(E)-11-hydroxy-7-oxo-1-phenylundec-2-enyl] acetate |
|---|---|
| PubChem CID | 135077924 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | [(E)-11-hydroxy-7-oxo-1-phenylundec-2-enyl] acetate |
| SMILES | CC(=O)OC(/C=C/CCCC(=O)CCCCO)c1ccccc1 |
| InChI | InChI=1S/C19H26O4/c1-16(21)23-19(17-10-4-2-5-11-17)14-7-3-6-12-18(22)13-8-9-15-20/h2,4-5,7,10-11,14,19-20H,3,6,8-9,12-13,15H2,1H3/b14-7+ |
| InChIKey | OOZBILJOFZFIGO-VGOFMYFVSA-N |
| XLogP | 3.75 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|