About [2-amino-1-(2-chlorophenyl)ethyl] ethaneperoxoate;hydrochloride
[2-amino-1-(2-chlorophenyl)ethyl] ethaneperoxoate;hydrochloride (PubChem CID 146368556) has the molecular formula C10H13Cl2NO3
and a molecular weight of 266.12 g/mol. Its IUPAC name is [2-amino-1-(2-chlorophenyl)ethyl] ethaneperoxoate;hydrochloride.
Molecular Properties
| Compound Name | [2-amino-1-(2-chlorophenyl)ethyl] ethaneperoxoate;hydrochloride |
| PubChem CID | 146368556 |
| Molecular Formula | C10H13Cl2NO3 |
| Molecular Weight | 266.12 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | [2-amino-1-(2-chlorophenyl)ethyl] ethaneperoxoate;hydrochloride |
| SMILES | CC(=O)OOC(CN)c1ccccc1Cl.Cl |
| InChI | InChI=1S/C10H12ClNO3.ClH/c1-7(13)14-15-10(6-12)8-4-2-3-5-9(8)11;/h2-5,10H,6,12H2,1H3;1H |
| InChIKey | IAOGYPLVMHXGSA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.12 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze [2-amino-1-(2-chlorophenyl)ethyl] ethaneperoxoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-amino-1-(2-chlorophenyl)ethyl] ethaneperoxoate;hydrochloride?
The IUPAC name of [2-amino-1-(2-chlorophenyl)ethyl] ethaneperoxoate;hydrochloride (CID 146368556) is [2-amino-1-(2-chlorophenyl)ethyl] ethaneperoxoate;hydrochloride.
What is the SMILES notation for [2-amino-1-(2-chlorophenyl)ethyl] ethaneperoxoate;hydrochloride?
The canonical SMILES for [2-amino-1-(2-chlorophenyl)ethyl] ethaneperoxoate;hydrochloride is CC(=O)OOC(CN)c1ccccc1Cl.Cl.
What is the InChIKey of [2-amino-1-(2-chlorophenyl)ethyl] ethaneperoxoate;hydrochloride?
The InChIKey is IAOGYPLVMHXGSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClNO3.ClH/c1-7(13)14-15-10(6-12)8-4-2-3-5-9(8)11;/h2-5,10H,6,12H2,1H3;1H.
What are the key properties of [2-amino-1-(2-chlorophenyl)ethyl] ethaneperoxoate;hydrochloride?
[2-amino-1-(2-chlorophenyl)ethyl] ethaneperoxoate;hydrochloride has a molecular weight of 266.12 g/mol, XLogP of 2.26, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-amino-1-(2-chlorophenyl)ethyl] ethaneperoxoate;hydrochloride is sourced from PubChem (CID 146368556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).