C12H17NaS — CID 23714324
sodium 2,5-di(propan-2-yl)benzenethiolate (PubChem CID 23714324) has the molecular formula C12H17NaS and a molecular weight of 216.32 g/mol. Its IUPAC name is sodium 2,5-di(propan-2-yl)benzenethiolate.
| Compound Name | sodium 2,5-di(propan-2-yl)benzenethiolate |
|---|---|
| PubChem CID | 23714324 |
| Molecular Formula | C12H17NaS |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | sodium 2,5-di(propan-2-yl)benzenethiolate |
| SMILES | CC(C)c1ccc(C(C)C)c([S-])c1.[Na+] |
| InChI | InChI=1S/C12H18S.Na/c1-8(2)10-5-6-11(9(3)4)12(13)7-10;/h5-9,13H,1-4H3;/q;+1/p-1 |
| InChIKey | SKCIVLFESKUFAZ-UHFFFAOYSA-M |
| XLogP | 0.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|