C30H52Si3 — CID 166001708
bis[2,5-di(propan-2-yl)phenyl]-bis(trimethylsilyl)silane (PubChem CID 166001708) has the molecular formula C30H52Si3 and a molecular weight of 497.00 g/mol. Its IUPAC name is bis[2,5-di(propan-2-yl)phenyl]-bis(trimethylsilyl)silane.
| Compound Name | bis[2,5-di(propan-2-yl)phenyl]-bis(trimethylsilyl)silane |
|---|---|
| PubChem CID | 166001708 |
| Molecular Formula | C30H52Si3 |
| Molecular Weight | 497.00 g/mol |
| Exact Mass | 496.34 |
| IUPAC Name | bis[2,5-di(propan-2-yl)phenyl]-bis(trimethylsilyl)silane |
| SMILES | CC(C)c1ccc(C(C)C)c([Si](c2cc(C(C)C)ccc2C(C)C)([Si](C)(C)C)[Si](C)(C)C)c1 |
| InChI | InChI=1S/C30H52Si3/c1-21(2)25-15-17-27(23(5)6)29(19-25)33(31(9,10)11,32(12,13)14)30-20-26(22(3)4)16-18-28(30)24(7)8/h15-24H,1-14H3 |
| InChIKey | QLZYQZFEOKFRDW-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.00 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|