About 2-[[2,5-di(propan-2-yl)phenyl]methyl]oxetane
2-[[2,5-di(propan-2-yl)phenyl]methyl]oxetane (PubChem CID 171770211) has the molecular formula C16H24O
and a molecular weight of 232.37 g/mol. Its IUPAC name is 2-[[2,5-di(propan-2-yl)phenyl]methyl]oxetane.
Molecular Properties
| Compound Name | 2-[[2,5-di(propan-2-yl)phenyl]methyl]oxetane |
| PubChem CID | 171770211 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 2-[[2,5-di(propan-2-yl)phenyl]methyl]oxetane |
| SMILES | CC(C)c1ccc(C(C)C)c(CC2CCO2)c1 |
| InChI | InChI=1S/C16H24O/c1-11(2)13-5-6-16(12(3)4)14(9-13)10-15-7-8-17-15/h5-6,9,11-12,15H,7-8,10H2,1-4H3 |
| InChIKey | VTXGMYVJFWHTCF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[[2,5-di(propan-2-yl)phenyl]methyl]oxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2,5-di(propan-2-yl)phenyl]methyl]oxetane?
The IUPAC name of 2-[[2,5-di(propan-2-yl)phenyl]methyl]oxetane (CID 171770211) is 2-[[2,5-di(propan-2-yl)phenyl]methyl]oxetane.
What is the SMILES notation for 2-[[2,5-di(propan-2-yl)phenyl]methyl]oxetane?
The canonical SMILES for 2-[[2,5-di(propan-2-yl)phenyl]methyl]oxetane is CC(C)c1ccc(C(C)C)c(CC2CCO2)c1.
What is the InChIKey of 2-[[2,5-di(propan-2-yl)phenyl]methyl]oxetane?
The InChIKey is VTXGMYVJFWHTCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O/c1-11(2)13-5-6-16(12(3)4)14(9-13)10-15-7-8-17-15/h5-6,9,11-12,15H,7-8,10H2,1-4H3.
What are the key properties of 2-[[2,5-di(propan-2-yl)phenyl]methyl]oxetane?
2-[[2,5-di(propan-2-yl)phenyl]methyl]oxetane has a molecular weight of 232.37 g/mol, XLogP of 4.26, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2,5-di(propan-2-yl)phenyl]methyl]oxetane is sourced from PubChem (CID 171770211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).