3-[2,5-di(propan-2-yl)phenyl]-2,2-dimethylpropanoic acid

C17H26O2 — CID 117411066

IUPAC3-[2,5-di(propan-2-yl)phenyl]-2,2-dimethylpropanoic acid
SMILESCC(C)c1ccc(C(C)C)c(CC(C)(C)C(=O)O)c1
InChIInChI=1S/C17H26O2/c1-11(2)13-7-8-15(12(3)4)14(9-13)10-17(5,6)16(18)19/h7-9,11-12H,10H2,1-6H3,(H,18,19)
InChIKeyKRJFWBYGMRGOOQ-UHFFFAOYSA-N
MW262.39 g/mol
LogP4.59
Rot. Bonds5

About 3-[2,5-di(propan-2-yl)phenyl]-2,2-dimethylpropanoic acid

3-[2,5-di(propan-2-yl)phenyl]-2,2-dimethylpropanoic acid (PubChem CID 117411066) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is 3-[2,5-di(propan-2-yl)phenyl]-2,2-dimethylpropanoic acid.

Molecular Properties

Compound Name3-[2,5-di(propan-2-yl)phenyl]-2,2-dimethylpropanoic acid
PubChem CID117411066
Molecular FormulaC17H26O2
Molecular Weight262.39 g/mol
Exact Mass262.19
IUPAC Name3-[2,5-di(propan-2-yl)phenyl]-2,2-dimethylpropanoic acid
SMILESCC(C)c1ccc(C(C)C)c(CC(C)(C)C(=O)O)c1
InChIInChI=1S/C17H26O2/c1-11(2)13-7-8-15(12(3)4)14(9-13)10-17(5,6)16(18)19/h7-9,11-12H,10H2,1-6H3,(H,18,19)
InChIKeyKRJFWBYGMRGOOQ-UHFFFAOYSA-N
XLogP4.59
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds5
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.39
LogP ≤ 54.59
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 3-[2,5-di(propan-2-yl)phenyl]-2,2-dimethylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[2,5-di(propan-2-yl)phenyl]-2,2-dimethylpropanoic acid?
The IUPAC name of 3-[2,5-di(propan-2-yl)phenyl]-2,2-dimethylpropanoic acid (CID 117411066) is 3-[2,5-di(propan-2-yl)phenyl]-2,2-dimethylpropanoic acid.
What is the SMILES notation for 3-[2,5-di(propan-2-yl)phenyl]-2,2-dimethylpropanoic acid?
The canonical SMILES for 3-[2,5-di(propan-2-yl)phenyl]-2,2-dimethylpropanoic acid is CC(C)c1ccc(C(C)C)c(CC(C)(C)C(=O)O)c1.
What is the InChIKey of 3-[2,5-di(propan-2-yl)phenyl]-2,2-dimethylpropanoic acid?
The InChIKey is KRJFWBYGMRGOOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O2/c1-11(2)13-7-8-15(12(3)4)14(9-13)10-17(5,6)16(18)19/h7-9,11-12H,10H2,1-6H3,(H,18,19).
What are the key properties of 3-[2,5-di(propan-2-yl)phenyl]-2,2-dimethylpropanoic acid?
3-[2,5-di(propan-2-yl)phenyl]-2,2-dimethylpropanoic acid has a molecular weight of 262.39 g/mol, XLogP of 4.59, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,5-di(propan-2-yl)phenyl]-2,2-dimethylpropanoic acid is sourced from PubChem (CID 117411066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).