C17H26ClNO — CID 63680547
3-chloro-N-[2,4-di(propan-2-yl)phenyl]-2,2-dimethylpropanamide (PubChem CID 63680547) has the molecular formula C17H26ClNO and a molecular weight of 295.85 g/mol. Its IUPAC name is 3-chloro-N-[2,4-di(propan-2-yl)phenyl]-2,2-dimethylpropanamide.
| Compound Name | 3-chloro-N-[2,4-di(propan-2-yl)phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 63680547 |
| Molecular Formula | C17H26ClNO |
| Molecular Weight | 295.85 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 3-chloro-N-[2,4-di(propan-2-yl)phenyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)c1ccc(NC(=O)C(C)(C)CCl)c(C(C)C)c1 |
| InChI | InChI=1S/C17H26ClNO/c1-11(2)13-7-8-15(14(9-13)12(3)4)19-16(20)17(5,6)10-18/h7-9,11-12H,10H2,1-6H3,(H,19,20) |
| InChIKey | ATYYMKUUTFXUMV-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.85 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|