C14H20ClNO — CID 155581097
2-chloro-N-[2,5-di(propan-2-yl)phenyl]acetamide (PubChem CID 155581097) has the molecular formula C14H20ClNO and a molecular weight of 253.77 g/mol. Its IUPAC name is 2-chloro-N-[2,5-di(propan-2-yl)phenyl]acetamide.
| Compound Name | 2-chloro-N-[2,5-di(propan-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 155581097 |
| Molecular Formula | C14H20ClNO |
| Molecular Weight | 253.77 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 2-chloro-N-[2,5-di(propan-2-yl)phenyl]acetamide |
| SMILES | CC(C)c1ccc(C(C)C)c(NC(=O)CCl)c1 |
| InChI | InChI=1S/C14H20ClNO/c1-9(2)11-5-6-12(10(3)4)13(7-11)16-14(17)8-15/h5-7,9-10H,8H2,1-4H3,(H,16,17) |
| InChIKey | RAGIJNSHTPQEDV-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.77 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|