C14H19ClINO — CID 71415983
2-chloro-N-[4-iodo-2,6-di(propan-2-yl)phenyl]acetamide (PubChem CID 71415983) has the molecular formula C14H19ClINO and a molecular weight of 379.67 g/mol. Its IUPAC name is 2-chloro-N-[4-iodo-2,6-di(propan-2-yl)phenyl]acetamide.
| Compound Name | 2-chloro-N-[4-iodo-2,6-di(propan-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 71415983 |
| Molecular Formula | C14H19ClINO |
| Molecular Weight | 379.67 g/mol |
| Exact Mass | 379.02 |
| IUPAC Name | 2-chloro-N-[4-iodo-2,6-di(propan-2-yl)phenyl]acetamide |
| SMILES | CC(C)c1cc(I)cc(C(C)C)c1NC(=O)CCl |
| InChI | InChI=1S/C14H19ClINO/c1-8(2)11-5-10(16)6-12(9(3)4)14(11)17-13(18)7-15/h5-6,8-9H,7H2,1-4H3,(H,17,18) |
| InChIKey | JRVCPQNVHLJARY-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.67 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|