C17H27N — CID 43103205
cyclobutyl-[2,4-di(propan-2-yl)phenyl]methanamine (PubChem CID 43103205) has the molecular formula C17H27N and a molecular weight of 245.41 g/mol. Its IUPAC name is cyclobutyl-[2,4-di(propan-2-yl)phenyl]methanamine.
| Compound Name | cyclobutyl-[2,4-di(propan-2-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 43103205 |
| Molecular Formula | C17H27N |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | cyclobutyl-[2,4-di(propan-2-yl)phenyl]methanamine |
| SMILES | CC(C)c1ccc(C(N)C2CCC2)c(C(C)C)c1 |
| InChI | InChI=1S/C17H27N/c1-11(2)14-8-9-15(16(10-14)12(3)4)17(18)13-6-5-7-13/h8-13,17H,5-7,18H2,1-4H3 |
| InChIKey | AZDRWBQZGCWHBQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |