About [2,4-di(propan-2-yl)phenyl]-(2-methylcyclopentyl)methanol
[2,4-di(propan-2-yl)phenyl]-(2-methylcyclopentyl)methanol (PubChem CID 107181587) has the molecular formula C19H30O
and a molecular weight of 274.45 g/mol. Its IUPAC name is [2,4-di(propan-2-yl)phenyl]-(2-methylcyclopentyl)methanol.
Molecular Properties
| Compound Name | [2,4-di(propan-2-yl)phenyl]-(2-methylcyclopentyl)methanol |
| PubChem CID | 107181587 |
| Molecular Formula | C19H30O |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | [2,4-di(propan-2-yl)phenyl]-(2-methylcyclopentyl)methanol |
| SMILES | CC(C)c1ccc(C(O)C2CCCC2C)c(C(C)C)c1 |
| InChI | InChI=1S/C19H30O/c1-12(2)15-9-10-17(18(11-15)13(3)4)19(20)16-8-6-7-14(16)5/h9-14,16,19-20H,6-8H2,1-5H3 |
| InChIKey | AUPAVJBLEVYMDJ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [2,4-di(propan-2-yl)phenyl]-(2-methylcyclopentyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,4-di(propan-2-yl)phenyl]-(2-methylcyclopentyl)methanol?
The IUPAC name of [2,4-di(propan-2-yl)phenyl]-(2-methylcyclopentyl)methanol (CID 107181587) is [2,4-di(propan-2-yl)phenyl]-(2-methylcyclopentyl)methanol.
What is the SMILES notation for [2,4-di(propan-2-yl)phenyl]-(2-methylcyclopentyl)methanol?
The canonical SMILES for [2,4-di(propan-2-yl)phenyl]-(2-methylcyclopentyl)methanol is CC(C)c1ccc(C(O)C2CCCC2C)c(C(C)C)c1.
What is the InChIKey of [2,4-di(propan-2-yl)phenyl]-(2-methylcyclopentyl)methanol?
The InChIKey is AUPAVJBLEVYMDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30O/c1-12(2)15-9-10-17(18(11-15)13(3)4)19(20)16-8-6-7-14(16)5/h9-14,16,19-20H,6-8H2,1-5H3.
What are the key properties of [2,4-di(propan-2-yl)phenyl]-(2-methylcyclopentyl)methanol?
[2,4-di(propan-2-yl)phenyl]-(2-methylcyclopentyl)methanol has a molecular weight of 274.45 g/mol, XLogP of 5.40, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2,4-di(propan-2-yl)phenyl]-(2-methylcyclopentyl)methanol is sourced from PubChem (CID 107181587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).